C15H28N2 — CID 123997422
7-hex-1-enyl-7-methyl-2,5,6,8,9,10-hexahydro-1H-1,4-diazecine (PubChem CID 123997422) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 7-hex-1-enyl-7-methyl-2,5,6,8,9,10-hexahydro-1H-1,4-diazecine.
| Compound Name | 7-hex-1-enyl-7-methyl-2,5,6,8,9,10-hexahydro-1H-1,4-diazecine |
|---|---|
| PubChem CID | 123997422 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 7-hex-1-enyl-7-methyl-2,5,6,8,9,10-hexahydro-1H-1,4-diazecine |
| SMILES | CCCCC=CC1(C)CCCNC/C=N\CC1 |
| InChI | InChI=1S/C15H28N2/c1-3-4-5-6-8-15(2)9-7-11-16-13-14-17-12-10-15/h6,8,14,16H,3-5,7,9-13H2,1-2H3/b8-6?,17-14- |
| InChIKey | CDZICLPTVMFJNB-DKVJLZHQSA-N |
| XLogP | 3.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|