About [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate
[4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate (PubChem CID 123997652) has the molecular formula C19H29NO5
and a molecular weight of 351.44 g/mol. Its IUPAC name is [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate |
| PubChem CID | 123997652 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate |
| SMILES | COCC1(C#N)C(=O)OC2C(OC(=O)C(C(C)(C)C)C(C)(C)C)CC21 |
| InChI | InChI=1S/C19H29NO5/c1-17(2,3)14(18(4,5)6)15(21)24-12-8-11-13(12)25-16(22)19(11,9-20)10-23-7/h11-14H,8,10H2,1-7H3 |
| InChIKey | FZINLWPWESKZES-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate?
The IUPAC name of [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate (CID 123997652) is [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate.
What is the SMILES notation for [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate?
The canonical SMILES for [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate is COCC1(C#N)C(=O)OC2C(OC(=O)C(C(C)(C)C)C(C)(C)C)CC21.
What is the InChIKey of [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate?
The InChIKey is FZINLWPWESKZES-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO5/c1-17(2,3)14(18(4,5)6)15(21)24-12-8-11-13(12)25-16(22)19(11,9-20)10-23-7/h11-14H,8,10H2,1-7H3.
What are the key properties of [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate?
[4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate has a molecular weight of 351.44 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-cyano-4-(methoxymethyl)-3-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 2-tert-butyl-3,3-dimethylbutanoate is sourced from PubChem (CID 123997652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).