C21H20F3N7 — CID 123997725
4-(6-piperazin-1-ylpyridine-2-carboximidoyl)-6-[5-(trifluoromethyl)-3-pyridinyl]pyridin-3-amine (PubChem CID 123997725) has the molecular formula C21H20F3N7 and a molecular weight of 427.43 g/mol. Its IUPAC name is 4-(6-piperazin-1-ylpyridine-2-carboximidoyl)-6-[5-(trifluoromethyl)-3-pyridinyl]pyridin-3-amine.
| Compound Name | 4-(6-piperazin-1-ylpyridine-2-carboximidoyl)-6-[5-(trifluoromethyl)-3-pyridinyl]pyridin-3-amine |
|---|---|
| PubChem CID | 123997725 |
| Molecular Formula | C21H20F3N7 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-(6-piperazin-1-ylpyridine-2-carboximidoyl)-6-[5-(trifluoromethyl)-3-pyridinyl]pyridin-3-amine |
| SMILES | [H]/N=C(\c1cccc(N2CCNCC2)n1)c1cc(-c2cncc(C(F)(F)F)c2)ncc1N |
| InChI | InChI=1S/C21H20F3N7/c22-21(23,24)14-8-13(10-28-11-14)18-9-15(16(25)12-29-18)20(26)17-2-1-3-19(30-17)31-6-4-27-5-7-31/h1-3,8-12,26-27H,4-7,25H2/b26-20- |
| InChIKey | LOESPGMVLJDVCU-QOMWVZHYSA-N |
| XLogP | 2.97 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|