C19H18N2O3 — CID 123998669
methyl 2-(2-anilinoethyl)-1-oxoisoquinoline-7-carboxylate (PubChem CID 123998669) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 2-(2-anilinoethyl)-1-oxoisoquinoline-7-carboxylate.
| Compound Name | methyl 2-(2-anilinoethyl)-1-oxoisoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 123998669 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | methyl 2-(2-anilinoethyl)-1-oxoisoquinoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2ccn(CCNc3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C19H18N2O3/c1-24-19(23)15-8-7-14-9-11-21(18(22)17(14)13-15)12-10-20-16-5-3-2-4-6-16/h2-9,11,13,20H,10,12H2,1H3 |
| InChIKey | YANRETJAOKGORP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |