C17H31N5OS2 — CID 123999026
2-(2,3,3a,4,5,6,7,7a-octahydro-[1,3]thiazolo[4,5-c]pyridin-2-ylmethylamino)-N-piperidin-2-ylthiolane-3-carboxamide (PubChem CID 123999026) has the molecular formula C17H31N5OS2 and a molecular weight of 385.60 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydro-[1,3]thiazolo[4,5-c]pyridin-2-ylmethylamino)-N-piperidin-2-ylthiolane-3-carboxamide.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-[1,3]thiazolo[4,5-c]pyridin-2-ylmethylamino)-N-piperidin-2-ylthiolane-3-carboxamide |
|---|---|
| PubChem CID | 123999026 |
| Molecular Formula | C17H31N5OS2 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-[1,3]thiazolo[4,5-c]pyridin-2-ylmethylamino)-N-piperidin-2-ylthiolane-3-carboxamide |
| SMILES | O=C(NC1CCCCN1)C1CCSC1NCC1NC2CNCCC2S1 |
| InChI | InChI=1S/C17H31N5OS2/c23-16(22-14-3-1-2-6-19-14)11-5-8-24-17(11)20-10-15-21-12-9-18-7-4-13(12)25-15/h11-15,17-21H,1-10H2,(H,22,23) |
| InChIKey | WZVZYIFNKVAEFK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |