C27H42ClF2N3O4 — CID 123999128
1-[3-[[1-[[(Z)-4-chloro-2-oxopent-3-enyl]-(2,2-dimethylbutyl)amino]-4,4-difluoro-2-methanimidoyl-1-oxopentan-3-ylidene]amino]propyl]cyclohexane-1-carboxylic acid (PubChem CID 123999128) has the molecular formula C27H42ClF2N3O4 and a molecular weight of 546.10 g/mol. Its IUPAC name is 1-[3-[[1-[[(Z)-4-chloro-2-oxopent-3-enyl]-(2,2-dimethylbutyl)amino]-4,4-difluoro-2-methanimidoyl-1-oxopentan-3-ylidene]amino]propyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-[[1-[[(Z)-4-chloro-2-oxopent-3-enyl]-(2,2-dimethylbutyl)amino]-4,4-difluoro-2-methanimidoyl-1-oxopentan-3-ylidene]amino]propyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123999128 |
| Molecular Formula | C27H42ClF2N3O4 |
| Molecular Weight | 546.10 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 1-[3-[[1-[[(Z)-4-chloro-2-oxopent-3-enyl]-(2,2-dimethylbutyl)amino]-4,4-difluoro-2-methanimidoyl-1-oxopentan-3-ylidene]amino]propyl]cyclohexane-1-carboxylic acid |
| SMILES | [H]/N=C/C(C(=O)N(CC(=O)/C=C(/C)Cl)CC(C)(C)CC)/C(=N/CCCC1(C(=O)O)CCCCC1)C(C)(F)F |
| InChI | InChI=1S/C27H42ClF2N3O4/c1-6-25(3,4)18-33(17-20(34)15-19(2)28)23(35)21(16-31)22(26(5,29)30)32-14-10-13-27(24(36)37)11-8-7-9-12-27/h15-16,21,31H,6-14,17-18H2,1-5H3,(H,36,37)/b19-15-,31-16+,32-22- |
| InChIKey | DASJXJXTRYABJR-QLLLPJNUSA-N |
| XLogP | 6.14 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.10 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|