C22H20Cl2O3 — CID 123999273
(1R,5S)-3-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 123999273) has the molecular formula C22H20Cl2O3 and a molecular weight of 403.31 g/mol. Its IUPAC name is (1R,5S)-3-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 123999273 |
| Molecular Formula | C22H20Cl2O3 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (1R,5S)-3-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(Oc2ccc(Cl)cc2Cl)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C22H20Cl2O3/c1-2-12-5-7-16(27-19-8-6-15(23)10-18(19)24)11-17(12)20-21(25)13-3-4-14(9-13)22(20)26/h5-8,10-11,13-14,20H,2-4,9H2,1H3/t13-,14+,20? |
| InChIKey | HBYDOXLVWQBBKY-RAKKMVLPSA-N |
| XLogP | 6.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|