C11H18N4 — CID 123999488
2-(3,4-dimethylpiperazin-1-yl)-4-methylpyrimidine (PubChem CID 123999488) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(3,4-dimethylpiperazin-1-yl)-4-methylpyrimidine.
| Compound Name | 2-(3,4-dimethylpiperazin-1-yl)-4-methylpyrimidine |
|---|---|
| PubChem CID | 123999488 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(3,4-dimethylpiperazin-1-yl)-4-methylpyrimidine |
| SMILES | Cc1ccnc(N2CCN(C)C(C)C2)n1 |
| InChI | InChI=1S/C11H18N4/c1-9-4-5-12-11(13-9)15-7-6-14(3)10(2)8-15/h4-5,10H,6-8H2,1-3H3 |
| InChIKey | LQOAQQUQKNIAGC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |