About 2-methyldec-2-enyl acetate
2-methyldec-2-enyl acetate (PubChem CID 123999734) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-methyldec-2-enyl acetate.
Molecular Properties
| Compound Name | 2-methyldec-2-enyl acetate |
| PubChem CID | 123999734 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-methyldec-2-enyl acetate |
| SMILES | CCCCCCCC=C(C)COC(C)=O |
| InChI | InChI=1S/C13H24O2/c1-4-5-6-7-8-9-10-12(2)11-15-13(3)14/h10H,4-9,11H2,1-3H3 |
| InChIKey | FBWKWVNOQRQRLD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldec-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldec-2-enyl acetate?
The IUPAC name of 2-methyldec-2-enyl acetate (CID 123999734) is 2-methyldec-2-enyl acetate.
What is the SMILES notation for 2-methyldec-2-enyl acetate?
The canonical SMILES for 2-methyldec-2-enyl acetate is CCCCCCCC=C(C)COC(C)=O.
What is the InChIKey of 2-methyldec-2-enyl acetate?
The InChIKey is FBWKWVNOQRQRLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-4-5-6-7-8-9-10-12(2)11-15-13(3)14/h10H,4-9,11H2,1-3H3.
What are the key properties of 2-methyldec-2-enyl acetate?
2-methyldec-2-enyl acetate has a molecular weight of 212.33 g/mol, XLogP of 3.86, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldec-2-enyl acetate is sourced from PubChem (CID 123999734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).