C43H42N6O5 — CID 123999960
3-[4-[[(2S)-2-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]-3-[3-(phenylmethoxymethyl)imidazol-4-yl]propanoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 123999960) has the molecular formula C43H42N6O5 and a molecular weight of 722.85 g/mol. Its IUPAC name is 3-[4-[[(2S)-2-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]-3-[3-(phenylmethoxymethyl)imidazol-4-yl]propanoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[(2S)-2-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]-3-[3-(phenylmethoxymethyl)imidazol-4-yl]propanoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123999960 |
| Molecular Formula | C43H42N6O5 |
| Molecular Weight | 722.85 g/mol |
| Exact Mass | 722.32 |
| IUPAC Name | 3-[4-[[(2S)-2-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]-3-[3-(phenylmethoxymethyl)imidazol-4-yl]propanoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(NC(=O)[C@H](Cc2cncn2COCc2ccccc2)NC(=O)c2ccc3c(C4CCCCC4)n(-c4ccccc4)nc3c2)cc1 |
| InChI | InChI=1S/C43H42N6O5/c50-40(51)23-18-30-16-20-34(21-17-30)45-43(53)39(25-36-26-44-28-48(36)29-54-27-31-10-4-1-5-11-31)46-42(52)33-19-22-37-38(24-33)47-49(35-14-8-3-9-15-35)41(37)32-12-6-2-7-13-32/h1,3-5,8-11,14-24,26,28,32,39H,2,6-7,12-13,25,27,29H2,(H,45,53)(H,46,52)(H,50,51)/t39-/m0/s1 |
| InChIKey | IRYURQAOHUFAGB-KDXMTYKHSA-N |
| XLogP | 7.52 |
| TPSA | 140.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.85 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|