C24H21N3O — CID 1240167
3,5-diamino-N-(4-methylphenyl)-N-naphthalen-2-ylbenzamide (PubChem CID 1240167) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 3,5-diamino-N-(4-methylphenyl)-N-naphthalen-2-ylbenzamide.
| Compound Name | 3,5-diamino-N-(4-methylphenyl)-N-naphthalen-2-ylbenzamide |
|---|---|
| PubChem CID | 1240167 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 3,5-diamino-N-(4-methylphenyl)-N-naphthalen-2-ylbenzamide |
| SMILES | Cc1ccc(N(C(=O)c2cc(N)cc(N)c2)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C24H21N3O/c1-16-6-9-22(10-7-16)27(24(28)19-12-20(25)15-21(26)13-19)23-11-8-17-4-2-3-5-18(17)14-23/h2-15H,25-26H2,1H3 |
| InChIKey | GMSRVZVQRHCQAR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|