About 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one
1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one (PubChem CID 1240423) has the molecular formula C17H12N2OS4
and a molecular weight of 388.56 g/mol. Its IUPAC name is 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one.
Molecular Properties
| Compound Name | 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one |
| PubChem CID | 1240423 |
| Molecular Formula | C17H12N2OS4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one |
| SMILES | O=C(CSc1nc2ccccc2s1)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H12N2OS4/c20-11(9-21-16-18-12-5-1-3-7-14(12)23-16)10-22-17-19-13-6-2-4-8-15(13)24-17/h1-8H,9-10H2 |
| InChIKey | BWTBZOLHOSVREZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one?
The IUPAC name of 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one (CID 1240423) is 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one.
What is the SMILES notation for 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one?
The canonical SMILES for 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one is O=C(CSc1nc2ccccc2s1)CSc1nc2ccccc2s1.
What is the InChIKey of 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one?
The InChIKey is BWTBZOLHOSVREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2OS4/c20-11(9-21-16-18-12-5-1-3-7-14(12)23-16)10-22-17-19-13-6-2-4-8-15(13)24-17/h1-8H,9-10H2.
What are the key properties of 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one?
1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one has a molecular weight of 388.56 g/mol, XLogP of 5.36, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1,3-benzothiazol-2-ylsulfanyl)propan-2-one is sourced from PubChem (CID 1240423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).