C17H25N5 — CID 1240590
6-(3,5-ditert-butylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 1240590) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 6-(3,5-ditert-butylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,5-ditert-butylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 1240590 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 6-(3,5-ditert-butylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)c1cc(-c2nc(N)nc(N)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25N5/c1-16(2,3)11-7-10(8-12(9-11)17(4,5)6)13-20-14(18)22-15(19)21-13/h7-9H,1-6H3,(H4,18,19,20,21,22) |
| InChIKey | BRXKDJXCTZWHHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |