C12H23N7O — CID 1240760
N'-[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-N'-methylacetohydrazide (PubChem CID 1240760) has the molecular formula C12H23N7O and a molecular weight of 281.36 g/mol. Its IUPAC name is N'-[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-N'-methylacetohydrazide.
| Compound Name | N'-[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 1240760 |
| Molecular Formula | C12H23N7O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | N'-[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-N'-methylacetohydrazide |
| SMILES | CC(=O)NN(C)c1nc(NC(C)C)nc(NC(C)C)n1 |
| InChI | InChI=1S/C12H23N7O/c1-7(2)13-10-15-11(14-8(3)4)17-12(16-10)19(6)18-9(5)20/h7-8H,1-6H3,(H,18,20)(H2,13,14,15,16,17) |
| InChIKey | FDERPKHECVEOLO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|