C20H18N2S — CID 1240993
(3R,4R)-6-(2,5-dimethylphenyl)-4-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-3-carbonitrile (PubChem CID 1240993) has the molecular formula C20H18N2S and a molecular weight of 318.45 g/mol. Its IUPAC name is (3R,4R)-6-(2,5-dimethylphenyl)-4-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-3-carbonitrile.
| Compound Name | (3R,4R)-6-(2,5-dimethylphenyl)-4-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 1240993 |
| Molecular Formula | C20H18N2S |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (3R,4R)-6-(2,5-dimethylphenyl)-4-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-3-carbonitrile |
| SMILES | Cc1ccc(C)c(C2=C[C@@H](c3ccccc3)[C@H](C#N)C(=S)N2)c1 |
| InChI | InChI=1S/C20H18N2S/c1-13-8-9-14(2)16(10-13)19-11-17(15-6-4-3-5-7-15)18(12-21)20(23)22-19/h3-11,17-18H,1-2H3,(H,22,23)/t17-,18-/m0/s1 |
| InChIKey | NXOYKMKWNRDJKO-ROUUACIJSA-N |
| XLogP | 4.50 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_cyano_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|