About N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide
N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 1241089) has the molecular formula C11H13N3OS
and a molecular weight of 235.31 g/mol. Its IUPAC name is N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide |
| PubChem CID | 1241089 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C11H13N3OS/c1-11(2,3)12-10(15)7-4-5-8-9(6-7)14-16-13-8/h4-6H,1-3H3,(H,12,15) |
| InChIKey | GWLYUIZJUHGNKV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide?
The IUPAC name of N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide (CID 1241089) is N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide.
What is the SMILES notation for N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide?
The canonical SMILES for N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide is CC(C)(C)NC(=O)c1ccc2nsnc2c1.
What is the InChIKey of N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide?
The InChIKey is GWLYUIZJUHGNKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3OS/c1-11(2,3)12-10(15)7-4-5-8-9(6-7)14-16-13-8/h4-6H,1-3H3,(H,12,15).
What are the key properties of N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide?
N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide has a molecular weight of 235.31 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,1,3-benzothiadiazole-5-carboxamide is sourced from PubChem (CID 1241089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).