About (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone
(2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone (PubChem CID 1241166) has the molecular formula C22H16N2OS
and a molecular weight of 356.45 g/mol. Its IUPAC name is (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone |
| PubChem CID | 1241166 |
| Molecular Formula | C22H16N2OS |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1sc(Nc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H16N2OS/c25-20(17-12-6-2-7-13-17)21-19(16-10-4-1-5-11-16)24-22(26-21)23-18-14-8-3-9-15-18/h1-15H,(H,23,24) |
| InChIKey | LQFHHNJNCSFAOJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone?
The IUPAC name of (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone (CID 1241166) is (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone.
What is the SMILES notation for (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone?
The canonical SMILES for (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone is O=C(c1ccccc1)c1sc(Nc2ccccc2)nc1-c1ccccc1.
What is the InChIKey of (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone?
The InChIKey is LQFHHNJNCSFAOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2OS/c25-20(17-12-6-2-7-13-17)21-19(16-10-4-1-5-11-16)24-22(26-21)23-18-14-8-3-9-15-18/h1-15H,(H,23,24).
What are the key properties of (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone?
(2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone has a molecular weight of 356.45 g/mol, XLogP of 5.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone is sourced from PubChem (CID 1241166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).