C12H14F9N — CID 124118197
3,5-Bis(trifluoromethyl)-1-(1,2,2-trifluoro-3-methylbut-3-enyl)piperidine (PubChem CID 124118197) has the molecular formula C12H14F9N and a molecular weight of 343.23 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-1-(1,2,2-trifluoro-3-methylbut-3-enyl)piperidine.
| Compound Name | 3,5-Bis(trifluoromethyl)-1-(1,2,2-trifluoro-3-methylbut-3-enyl)piperidine |
|---|---|
| PubChem CID | 124118197 |
| Molecular Formula | C12H14F9N |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-1-(1,2,2-trifluoro-3-methylbut-3-enyl)piperidine |
| SMILES | CC(=C)C(C(N1CC(CC(C1)C(F)(F)F)C(F)(F)F)F)(F)F |
| InChI | InChI=1S/C12H14F9N/c1-6(2)10(14,15)9(13)22-4-7(11(16,17)18)3-8(5-22)12(19,20)21/h7-9H,1,3-5H2,2H3 |
| InChIKey | ISWAWBRMJYFIEF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 390 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|