C22H16Cl2N2O2 — CID 1241199
1,3-bis[(4-chlorophenyl)methyl]quinazoline-2,4-dione (PubChem CID 1241199) has the molecular formula C22H16Cl2N2O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is 1,3-bis[(4-chlorophenyl)methyl]quinazoline-2,4-dione.
| Compound Name | 1,3-bis[(4-chlorophenyl)methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 1241199 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 1,3-bis[(4-chlorophenyl)methyl]quinazoline-2,4-dione |
| SMILES | O=c1c2ccccc2n(Cc2ccc(Cl)cc2)c(=O)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16Cl2N2O2/c23-17-9-5-15(6-10-17)13-25-20-4-2-1-3-19(20)21(27)26(22(25)28)14-16-7-11-18(24)12-8-16/h1-12H,13-14H2 |
| InChIKey | FXDCWNHGMSHGDN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |