About US10106501, Example BJ-3
US10106501, Example BJ-3 (PubChem CID 124122878) has the molecular formula C21H18Cl2F3N3O2
and a molecular weight of 472.30 g/mol. Its IUPAC name is [2,4-dichloro-3-[[1,4-dimethyl-6-(trifluoromethyl)benzimidazol-2-yl]methyl]phenyl]-(3-hydroxyazetidin-1-yl)methanone.
Molecular Properties
| Compound Name | US10106501, Example BJ-3 |
| PubChem CID | 124122878 |
| Molecular Formula | C21H18Cl2F3N3O2 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | [2,4-dichloro-3-[[1,4-dimethyl-6-(trifluoromethyl)benzimidazol-2-yl]methyl]phenyl]-(3-hydroxyazetidin-1-yl)methanone |
| SMILES | CC1=CC(=CC2=C1N=C(N2C)CC3=C(C=CC(=C3Cl)C(=O)N4CC(C4)O)Cl)C(F)(F)F |
| InChI | InChI=1S/C21H18Cl2F3N3O2/c1-10-5-11(21(24,25)26)6-16-19(10)27-17(28(16)2)7-14-15(22)4-3-13(18(14)23)20(31)29-8-12(30)9-29/h3-6,12,30H,7-9H2,1-2H3 |
| InChIKey | JENNBNIJQFIDIC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | 679 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze US10106501, Example BJ-3 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10106501, Example BJ-3?
The IUPAC name of US10106501, Example BJ-3 (CID 124122878) is [2,4-dichloro-3-[[1,4-dimethyl-6-(trifluoromethyl)benzimidazol-2-yl]methyl]phenyl]-(3-hydroxyazetidin-1-yl)methanone.
What is the SMILES notation for US10106501, Example BJ-3?
The canonical SMILES for US10106501, Example BJ-3 is CC1=CC(=CC2=C1N=C(N2C)CC3=C(C=CC(=C3Cl)C(=O)N4CC(C4)O)Cl)C(F)(F)F.
What is the InChIKey of US10106501, Example BJ-3?
The InChIKey is JENNBNIJQFIDIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18Cl2F3N3O2/c1-10-5-11(21(24,25)26)6-16-19(10)27-17(28(16)2)7-14-15(22)4-3-13(18(14)23)20(31)29-8-12(30)9-29/h3-6,12,30H,7-9H2,1-2H3.
What are the key properties of US10106501, Example BJ-3?
US10106501, Example BJ-3 has a molecular weight of 472.30 g/mol, XLogP of 4.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for US10106501, Example BJ-3 is sourced from PubChem (CID 124122878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).