About N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide (PubChem CID 1241231) has the molecular formula C19H30N2O4
and a molecular weight of 350.46 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide |
| PubChem CID | 1241231 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H30N2O4/c1-6-24-16-13-15(21-8-10-23-11-9-21)17(25-7-2)12-14(16)20-18(22)19(3,4)5/h12-13H,6-11H2,1-5H3,(H,20,22) |
| InChIKey | IKTPMURSIAXWEO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide (CID 1241231) is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide is CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C(C)(C)C.
What is the InChIKey of N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide?
The InChIKey is IKTPMURSIAXWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O4/c1-6-24-16-13-15(21-8-10-23-11-9-21)17(25-7-2)12-14(16)20-18(22)19(3,4)5/h12-13H,6-11H2,1-5H3,(H,20,22).
What are the key properties of N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide?
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide has a molecular weight of 350.46 g/mol, XLogP of 3.31, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 1241231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).