About US10759793, Example 33
US10759793, Example 33 (PubChem CID 124125657) has the molecular formula C25H29FN8O3
and a molecular weight of 508.50 g/mol. Its IUPAC name is 1-[(3R)-3-[[5-fluoro-6-[1-(2-hydroxy-2-methylpropyl)pyrazol-4-yl]-2-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-4-yl]amino]piperidin-1-yl]-2-hydroxyethanone.
Molecular Properties
| Compound Name | US10759793, Example 33 |
| PubChem CID | 124125657 |
| Molecular Formula | C25H29FN8O3 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 1-[(3R)-3-[[5-fluoro-6-[1-(2-hydroxy-2-methylpropyl)pyrazol-4-yl]-2-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-4-yl]amino]piperidin-1-yl]-2-hydroxyethanone |
| SMILES | CC(C)(CN1C=C(C=N1)C2=C(C(=NC(=N2)C3=C4C=CC=CN4N=C3)N[C@@H]5CCCN(C5)C(=O)CO)F)O |
| InChI | InChI=1S/C25H29FN8O3/c1-25(2,37)15-33-12-16(10-27-33)22-21(26)24(29-17-6-5-8-32(13-17)20(36)14-35)31-23(30-22)18-11-28-34-9-4-3-7-19(18)34/h3-4,7,9-12,17,35,37H,5-6,8,13-15H2,1-2H3,(H,29,30,31)/t17-/m1/s1 |
| InChIKey | PPPZKRNWVZENFR-QGZVFWFLSA-N |
| XLogP | 0.70 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | 793 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze US10759793, Example 33 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10759793, Example 33?
The IUPAC name of US10759793, Example 33 (CID 124125657) is 1-[(3R)-3-[[5-fluoro-6-[1-(2-hydroxy-2-methylpropyl)pyrazol-4-yl]-2-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-4-yl]amino]piperidin-1-yl]-2-hydroxyethanone.
What is the SMILES notation for US10759793, Example 33?
The canonical SMILES for US10759793, Example 33 is CC(C)(CN1C=C(C=N1)C2=C(C(=NC(=N2)C3=C4C=CC=CN4N=C3)N[C@@H]5CCCN(C5)C(=O)CO)F)O.
What is the InChIKey of US10759793, Example 33?
The InChIKey is PPPZKRNWVZENFR-QGZVFWFLSA-N. The full InChI is InChI=1S/C25H29FN8O3/c1-25(2,37)15-33-12-16(10-27-33)22-21(26)24(29-17-6-5-8-32(13-17)20(36)14-35)31-23(30-22)18-11-28-34-9-4-3-7-19(18)34/h3-4,7,9-12,17,35,37H,5-6,8,13-15H2,1-2H3,(H,29,30,31)/t17-/m1/s1.
What are the key properties of US10759793, Example 33?
US10759793, Example 33 has a molecular weight of 508.50 g/mol, XLogP of 0.70, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for US10759793, Example 33 is sourced from PubChem (CID 124125657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).