C11H14O — CID 1241414
(1S,2S,3R,4S,6R,7S,8R,10R)-11-oxapentacyclo[5.4.1.02,6.03,10.04,8]dodecane (PubChem CID 1241414) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (1S,2S,3R,4S,6R,7S,8R,10R)-11-oxapentacyclo[5.4.1.02,6.03,10.04,8]dodecane.
| Compound Name | (1S,2S,3R,4S,6R,7S,8R,10R)-11-oxapentacyclo[5.4.1.02,6.03,10.04,8]dodecane |
|---|---|
| PubChem CID | 1241414 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (1S,2S,3R,4S,6R,7S,8R,10R)-11-oxapentacyclo[5.4.1.02,6.03,10.04,8]dodecane |
| SMILES | C1[C@@H]2[C@H]3C[C@@H]4O[C@@H]5C[C@H]3[C@H]1[C@@H]5[C@H]24 |
| InChI | InChI=1S/C11H14O/c1-6-4-2-8-10(6)11-7(1)5(4)3-9(11)12-8/h4-11H,1-3H2/t4-,5+,6+,7-,8-,9+,10+,11- |
| InChIKey | CFOAUYKRGYUXNC-JJSSPVMXSA-N |
| XLogP | 1.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |