C21H19FN4O2S — CID 1241652
2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 1241652) has the molecular formula C21H19FN4O2S and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 1241652 |
| Molecular Formula | C21H19FN4O2S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | Cc1[nH]c2ccc(-c3nnc(SCC(=O)NCc4ccc(F)cc4)o3)cc2c1C |
| InChI | InChI=1S/C21H19FN4O2S/c1-12-13(2)24-18-8-5-15(9-17(12)18)20-25-26-21(28-20)29-11-19(27)23-10-14-3-6-16(22)7-4-14/h3-9,24H,10-11H2,1-2H3,(H,23,27) |
| InChIKey | CYCMPHIUHWWFIG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|