About 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline
3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline (PubChem CID 1241910) has the molecular formula C15H15ClINO2
and a molecular weight of 403.65 g/mol. Its IUPAC name is 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline.
Molecular Properties
| Compound Name | 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline |
| PubChem CID | 1241910 |
| Molecular Formula | C15H15ClINO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(CNc2cccc(Cl)c2)cc(I)c1OC |
| InChI | InChI=1S/C15H15ClINO2/c1-19-14-7-10(6-13(17)15(14)20-2)9-18-12-5-3-4-11(16)8-12/h3-8,18H,9H2,1-2H3 |
| InChIKey | QUQGDSICFWPIFQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline?
The IUPAC name of 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline (CID 1241910) is 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline.
What is the SMILES notation for 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline?
The canonical SMILES for 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline is COc1cc(CNc2cccc(Cl)c2)cc(I)c1OC.
What is the InChIKey of 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline?
The InChIKey is QUQGDSICFWPIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClINO2/c1-19-14-7-10(6-13(17)15(14)20-2)9-18-12-5-3-4-11(16)8-12/h3-8,18H,9H2,1-2H3.
What are the key properties of 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline?
3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline has a molecular weight of 403.65 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]aniline is sourced from PubChem (CID 1241910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).