About propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate
propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate (PubChem CID 1242269) has the molecular formula C18H20N2O4S2
and a molecular weight of 392.50 g/mol. Its IUPAC name is propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate |
| PubChem CID | 1242269 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate |
| SMILES | Cc1sc2nc(SCC(=O)OC(C)C)n(Cc3ccco3)c(=O)c2c1C |
| InChI | InChI=1S/C18H20N2O4S2/c1-10(2)24-14(21)9-25-18-19-16-15(11(3)12(4)26-16)17(22)20(18)8-13-6-5-7-23-13/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | LKUSXKGQYXNHLQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate?
The IUPAC name of propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate (CID 1242269) is propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate.
What is the SMILES notation for propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate?
The canonical SMILES for propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate is Cc1sc2nc(SCC(=O)OC(C)C)n(Cc3ccco3)c(=O)c2c1C.
What is the InChIKey of propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate?
The InChIKey is LKUSXKGQYXNHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4S2/c1-10(2)24-14(21)9-25-18-19-16-15(11(3)12(4)26-16)17(22)20(18)8-13-6-5-7-23-13/h5-7,10H,8-9H2,1-4H3.
What are the key properties of propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate?
propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate has a molecular weight of 392.50 g/mol, XLogP of 3.76, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[3-(furan-2-ylmethyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetate is sourced from PubChem (CID 1242269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).