C24H22Cl2N2O2 — CID 1242332
1-N,3-N-bis[2-(4-chlorophenyl)ethyl]benzene-1,3-dicarboxamide (PubChem CID 1242332) has the molecular formula C24H22Cl2N2O2 and a molecular weight of 441.36 g/mol. Its IUPAC name is 1-N,3-N-bis[2-(4-chlorophenyl)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[2-(4-chlorophenyl)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 1242332 |
| Molecular Formula | C24H22Cl2N2O2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-N,3-N-bis[2-(4-chlorophenyl)ethyl]benzene-1,3-dicarboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1cccc(C(=O)NCCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H22Cl2N2O2/c25-21-8-4-17(5-9-21)12-14-27-23(29)19-2-1-3-20(16-19)24(30)28-15-13-18-6-10-22(26)11-7-18/h1-11,16H,12-15H2,(H,27,29)(H,28,30) |
| InChIKey | RSBXBWAHHDJYLU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |