C15H15N3O3S — CID 1242526
1,3-dimethyl-2-oxo-N-phenylbenzimidazole-5-sulfonamide (PubChem CID 1242526) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 1,3-dimethyl-2-oxo-N-phenylbenzimidazole-5-sulfonamide.
| Compound Name | 1,3-dimethyl-2-oxo-N-phenylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 1242526 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1,3-dimethyl-2-oxo-N-phenylbenzimidazole-5-sulfonamide |
| SMILES | Cn1c(=O)n(C)c2cc(S(=O)(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C15H15N3O3S/c1-17-13-9-8-12(10-14(13)18(2)15(17)19)22(20,21)16-11-6-4-3-5-7-11/h3-10,16H,1-2H3 |
| InChIKey | ORKKPUYEJLTYJT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |