C21H21IN2O3S — CID 1243902
N-(2-ethyl-6-methylphenyl)-2-[(3R)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide (PubChem CID 1243902) has the molecular formula C21H21IN2O3S and a molecular weight of 508.38 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2-[(3R)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2-[(3R)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1243902 |
| Molecular Formula | C21H21IN2O3S |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2-[(3R)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
| SMILES | CCc1cccc(C)c1NC(=O)CS[C@@H]1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C21H21IN2O3S/c1-3-14-6-4-5-13(2)20(14)23-18(25)12-28-17-11-19(26)24(21(17)27)16-9-7-15(22)8-10-16/h4-10,17H,3,11-12H2,1-2H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | AXLHJHSRGZASLK-QGZVFWFLSA-N |
| XLogP | 4.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|