C22H19BrN2O3S — CID 1243935
O-[3-[(4-ethoxyphenyl)carbamoyl]phenyl] N-(4-bromophenyl)carbamothioate (PubChem CID 1243935) has the molecular formula C22H19BrN2O3S and a molecular weight of 471.38 g/mol. Its IUPAC name is O-[3-[(4-ethoxyphenyl)carbamoyl]phenyl] N-(4-bromophenyl)carbamothioate.
| Compound Name | O-[3-[(4-ethoxyphenyl)carbamoyl]phenyl] N-(4-bromophenyl)carbamothioate |
|---|---|
| PubChem CID | 1243935 |
| Molecular Formula | C22H19BrN2O3S |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | O-[3-[(4-ethoxyphenyl)carbamoyl]phenyl] N-(4-bromophenyl)carbamothioate |
| SMILES | CCOc1ccc(NC(=O)c2cccc(OC(=S)Nc3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C22H19BrN2O3S/c1-2-27-19-12-10-17(11-13-19)24-21(26)15-4-3-5-20(14-15)28-22(29)25-18-8-6-16(23)7-9-18/h3-14H,2H2,1H3,(H,24,26)(H,25,29) |
| InChIKey | BQQUJNGMHMPQSL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|