C8H2Cl4O4 — CID 12442
3,4,5,6-tetrachlorophthalic acid (PubChem CID 12442) has the molecular formula C8H2Cl4O4 and a molecular weight of 303.91 g/mol. Its IUPAC name is 3,4,5,6-tetrachlorophthalic acid.
| Compound Name | 3,4,5,6-tetrachlorophthalic acid |
|---|---|
| PubChem CID | 12442 |
| Molecular Formula | C8H2Cl4O4 |
| Molecular Weight | 303.91 g/mol |
| Exact Mass | 301.87 |
| IUPAC Name | 3,4,5,6-tetrachlorophthalic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C8H2Cl4O4/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11/h(H,13,14)(H,15,16) |
| InChIKey | WZHHYIOUKQNLQM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|