About (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone
(2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone (PubChem CID 1244283) has the molecular formula C19H19ClF2N2O
and a molecular weight of 364.82 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone |
| PubChem CID | 1244283 |
| Molecular Formula | C19H19ClF2N2O |
| Molecular Weight | 364.82 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H19ClF2N2O/c20-16-13-18(22)17(21)12-15(16)19(25)24-10-8-23(9-11-24)7-6-14-4-2-1-3-5-14/h1-5,12-13H,6-11H2 |
| InChIKey | CGWWZVFTLIYFKW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone?
The IUPAC name of (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone (CID 1244283) is (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone.
What is the SMILES notation for (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone?
The canonical SMILES for (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone is O=C(c1cc(F)c(F)cc1Cl)N1CCN(CCc2ccccc2)CC1.
What is the InChIKey of (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone?
The InChIKey is CGWWZVFTLIYFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClF2N2O/c20-16-13-18(22)17(21)12-15(16)19(25)24-10-8-23(9-11-24)7-6-14-4-2-1-3-5-14/h1-5,12-13H,6-11H2.
What are the key properties of (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone?
(2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone has a molecular weight of 364.82 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4,5-difluorophenyl)-[4-(2-phenylethyl)piperazin-1-yl]methanone is sourced from PubChem (CID 1244283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).