C21H38N2O4 — CID 1244568
bis(2,2,6,6-tetramethylpiperidin-4-yl) propanedioate (PubChem CID 1244568) has the molecular formula C21H38N2O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) propanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) propanedioate |
|---|---|
| PubChem CID | 1244568 |
| Molecular Formula | C21H38N2O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) propanedioate |
| SMILES | CC1(C)CC(OC(=O)CC(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H38N2O4/c1-18(2)10-14(11-19(3,4)22-18)26-16(24)9-17(25)27-15-12-20(5,6)23-21(7,8)13-15/h14-15,22-23H,9-13H2,1-8H3 |
| InChIKey | DGBLGWVHPYOSAI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|