About N-Ethyl-3-methyl-1,2-oxazol-5-amine
N-Ethyl-3-methyl-1,2-oxazol-5-amine (PubChem CID 12446345) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is N-ethyl-3-methyl-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | N-Ethyl-3-methyl-1,2-oxazol-5-amine |
| PubChem CID | 12446345 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | N-ethyl-3-methyl-1,2-oxazol-5-amine |
| SMILES | CCNC1=CC(=NO1)C |
| InChI | InChI=1S/C6H10N2O/c1-3-7-6-4-5(2)8-9-6/h4,7H,3H2,1-2H3 |
| InChIKey | GVONDJIPXGUCHI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | 87 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-Ethyl-3-methyl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-Ethyl-3-methyl-1,2-oxazol-5-amine?
The IUPAC name of N-Ethyl-3-methyl-1,2-oxazol-5-amine (CID 12446345) is N-ethyl-3-methyl-1,2-oxazol-5-amine.
What is the SMILES notation for N-Ethyl-3-methyl-1,2-oxazol-5-amine?
The canonical SMILES for N-Ethyl-3-methyl-1,2-oxazol-5-amine is CCNC1=CC(=NO1)C.
What is the InChIKey of N-Ethyl-3-methyl-1,2-oxazol-5-amine?
The InChIKey is GVONDJIPXGUCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-3-7-6-4-5(2)8-9-6/h4,7H,3H2,1-2H3.
What are the key properties of N-Ethyl-3-methyl-1,2-oxazol-5-amine?
N-Ethyl-3-methyl-1,2-oxazol-5-amine has a molecular weight of 126.16 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-Ethyl-3-methyl-1,2-oxazol-5-amine is sourced from PubChem (CID 12446345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).