C23H29N3O3 — CID 124500264
benzyl (2S)-2-(2-methyl-6-morpholin-4-yl-3-pyridinyl)piperidine-1-carboxylate (PubChem CID 124500264) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is benzyl (2S)-2-(2-methyl-6-morpholin-4-yl-3-pyridinyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(2-methyl-6-morpholin-4-yl-3-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 124500264 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | benzyl (2S)-2-(2-methyl-6-morpholin-4-yl-3-pyridinyl)piperidine-1-carboxylate |
| SMILES | Cc1nc(N2CCOCC2)ccc1[C@@H]1CCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H29N3O3/c1-18-20(10-11-22(24-18)25-13-15-28-16-14-25)21-9-5-6-12-26(21)23(27)29-17-19-7-3-2-4-8-19/h2-4,7-8,10-11,21H,5-6,9,12-17H2,1H3/t21-/m0/s1 |
| InChIKey | KDPAIVUEDGTAAK-NRFANRHFSA-N |
| XLogP | 4.09 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |