C13H22N4 — CID 124501480
(1S)-1-(5-methyl-6-piperazin-1-yl-3-pyridinyl)propan-1-amine (PubChem CID 124501480) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is (1S)-1-(5-methyl-6-piperazin-1-yl-3-pyridinyl)propan-1-amine.
| Compound Name | (1S)-1-(5-methyl-6-piperazin-1-yl-3-pyridinyl)propan-1-amine |
|---|---|
| PubChem CID | 124501480 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (1S)-1-(5-methyl-6-piperazin-1-yl-3-pyridinyl)propan-1-amine |
| SMILES | CC[C@H](N)c1cnc(N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C13H22N4/c1-3-12(14)11-8-10(2)13(16-9-11)17-6-4-15-5-7-17/h8-9,12,15H,3-7,14H2,1-2H3/t12-/m0/s1 |
| InChIKey | GSNDNEGNUUQFKB-LBPRGKRZSA-N |
| XLogP | 1.21 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |