C15H16N2O — CID 124503031
(S)-[6-(cyclopropylamino)-3-pyridinyl]-phenylmethanol (PubChem CID 124503031) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is (S)-[6-(cyclopropylamino)-3-pyridinyl]-phenylmethanol.
| Compound Name | (S)-[6-(cyclopropylamino)-3-pyridinyl]-phenylmethanol |
|---|---|
| PubChem CID | 124503031 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (S)-[6-(cyclopropylamino)-3-pyridinyl]-phenylmethanol |
| SMILES | O[C@@H](c1ccccc1)c1ccc(NC2CC2)nc1 |
| InChI | InChI=1S/C15H16N2O/c18-15(11-4-2-1-3-5-11)12-6-9-14(16-10-12)17-13-7-8-13/h1-6,9-10,13,15,18H,7-8H2,(H,16,17)/t15-/m0/s1 |
| InChIKey | MPWDWPXMOVDZPM-HNNXBMFYSA-N |
| XLogP | 2.74 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |