C16H15ClN2O — CID 124503553
(3S,4R)-3-amino-4-(3-chlorophenyl)-1-(3-methylphenyl)azetidin-2-one (PubChem CID 124503553) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-(3-chlorophenyl)-1-(3-methylphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-amino-4-(3-chlorophenyl)-1-(3-methylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 124503553 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (3S,4R)-3-amino-4-(3-chlorophenyl)-1-(3-methylphenyl)azetidin-2-one |
| SMILES | Cc1cccc(N2C(=O)[C@@H](N)[C@H]2c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H15ClN2O/c1-10-4-2-7-13(8-10)19-15(14(18)16(19)20)11-5-3-6-12(17)9-11/h2-9,14-15H,18H2,1H3/t14-,15+/m0/s1 |
| InChIKey | HUILUADKMQLMRD-LSDHHAIUSA-N |
| XLogP | 3.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |