C17H19N3 — CID 124504493
3-[(1R)-1,2-diphenylethyl]-1,2,5,6-tetrahydro-1,2,4-triazine (PubChem CID 124504493) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[(1R)-1,2-diphenylethyl]-1,2,5,6-tetrahydro-1,2,4-triazine.
| Compound Name | 3-[(1R)-1,2-diphenylethyl]-1,2,5,6-tetrahydro-1,2,4-triazine |
|---|---|
| PubChem CID | 124504493 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-[(1R)-1,2-diphenylethyl]-1,2,5,6-tetrahydro-1,2,4-triazine |
| SMILES | c1ccc(C[C@@H](C2=NCCNN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3/c1-3-7-14(8-4-1)13-16(15-9-5-2-6-10-15)17-18-11-12-19-20-17/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m1/s1 |
| InChIKey | QQZDRBLYFGVUER-MRXNPFEDSA-N |
| XLogP | 2.52 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |