About ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate
ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate (PubChem CID 124505890) has the molecular formula C13H22N4O2S
and a molecular weight of 298.41 g/mol. Its IUPAC name is ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate |
| PubChem CID | 124505890 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N1CCN(c2nc(CC)ns2)CC1 |
| InChI | InChI=1S/C13H22N4O2S/c1-4-11-14-13(20-15-11)17-8-6-16(7-9-17)10(3)12(18)19-5-2/h10H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | SFLQYOFQBXAHOE-SNVBAGLBSA-N |
| XLogP | 1.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate?
The IUPAC name of ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate (CID 124505890) is ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate.
What is the SMILES notation for ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate?
The canonical SMILES for ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate is CCOC(=O)[C@@H](C)N1CCN(c2nc(CC)ns2)CC1.
What is the InChIKey of ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate?
The InChIKey is SFLQYOFQBXAHOE-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H22N4O2S/c1-4-11-14-13(20-15-11)17-8-6-16(7-9-17)10(3)12(18)19-5-2/h10H,4-9H2,1-3H3/t10-/m1/s1.
What are the key properties of ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate?
ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate has a molecular weight of 298.41 g/mol, XLogP of 1.17, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]propanoate is sourced from PubChem (CID 124505890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).