C17H16FN3O2S — CID 124505944
(4S)-4-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]-1,3-thiazolidin-2-one (PubChem CID 124505944) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is (4S)-4-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]-1,3-thiazolidin-2-one.
| Compound Name | (4S)-4-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 124505944 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (4S)-4-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1N[C@@H](C(=O)N2CC=C(c3c[nH]c4cc(F)ccc34)CC2)CS1 |
| InChI | InChI=1S/C17H16FN3O2S/c18-11-1-2-12-13(8-19-14(12)7-11)10-3-5-21(6-4-10)16(22)15-9-24-17(23)20-15/h1-3,7-8,15,19H,4-6,9H2,(H,20,23)/t15-/m1/s1 |
| InChIKey | QHVIPNWPYZEWDC-OAHLLOKOSA-N |
| XLogP | 2.75 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|