About (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone
(4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone (PubChem CID 124505949) has the molecular formula C14H18BrNO2
and a molecular weight of 312.21 g/mol. Its IUPAC name is (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone.
Molecular Properties
| Compound Name | (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone |
| PubChem CID | 124505949 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone |
| SMILES | Cc1cc(Br)ccc1C(=O)N1[C@H](C)COC[C@@H]1C |
| InChI | InChI=1S/C14H18BrNO2/c1-9-6-12(15)4-5-13(9)14(17)16-10(2)7-18-8-11(16)3/h4-6,10-11H,7-8H2,1-3H3/t10-,11+ |
| InChIKey | WINFNJONQPREFT-PHIMTYICSA-N |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone?
The IUPAC name of (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone (CID 124505949) is (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone.
What is the SMILES notation for (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone?
The canonical SMILES for (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone is Cc1cc(Br)ccc1C(=O)N1[C@H](C)COC[C@@H]1C.
What is the InChIKey of (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone?
The InChIKey is WINFNJONQPREFT-PHIMTYICSA-N. The full InChI is InChI=1S/C14H18BrNO2/c1-9-6-12(15)4-5-13(9)14(17)16-10(2)7-18-8-11(16)3/h4-6,10-11H,7-8H2,1-3H3/t10-,11+.
What are the key properties of (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone?
(4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone has a molecular weight of 312.21 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-methylphenyl)-[(3R,5S)-3,5-dimethylmorpholin-4-yl]methanone is sourced from PubChem (CID 124505949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).