C28H30N4O3 — CID 124507298
(2R,6S,20S)-20-[(dimethylamino)methyl]-17-oxa-4,14,21-triazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),7(29),8,10,12,22,24,26-octaene-3,5-dione (PubChem CID 124507298) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is (2R,6S,20S)-20-[(dimethylamino)methyl]-17-oxa-4,14,21-triazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),7(29),8,10,12,22,24,26-octaene-3,5-dione.
| Compound Name | (2R,6S,20S)-20-[(dimethylamino)methyl]-17-oxa-4,14,21-triazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),7(29),8,10,12,22,24,26-octaene-3,5-dione |
|---|---|
| PubChem CID | 124507298 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (2R,6S,20S)-20-[(dimethylamino)methyl]-17-oxa-4,14,21-triazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),7(29),8,10,12,22,24,26-octaene-3,5-dione |
| SMILES | CN(C)C[C@@H]1CCOCCn2cc(c3ccccc32)[C@H]2C(=O)NC(=O)[C@H]2c2cn1c1ccccc21 |
| InChI | InChI=1S/C28H30N4O3/c1-30(2)15-18-11-13-35-14-12-31-16-21(19-7-3-5-9-23(19)31)25-26(28(34)29-27(25)33)22-17-32(18)24-10-6-4-8-20(22)24/h3-10,16-18,25-26H,11-15H2,1-2H3,(H,29,33,34)/t18-,25+,26-/m0/s1 |
| InChIKey | SRZQCVPKYNBFOG-IMDCKVJKSA-N |
| XLogP | 3.64 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|