C14H14FN5O2S — CID 124507844
(3S,7aR)-N-(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 124507844) has the molecular formula C14H14FN5O2S and a molecular weight of 335.36 g/mol. Its IUPAC name is (3S,7aR)-N-(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aR)-N-(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 124507844 |
| Molecular Formula | C14H14FN5O2S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (3S,7aR)-N-(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@@]12CCC(=O)N1[C@@H](C(=O)Nc1nc3ccc(F)cn3n1)CS2 |
| InChI | InChI=1S/C14H14FN5O2S/c1-14-5-4-11(21)20(14)9(7-23-14)12(22)17-13-16-10-3-2-8(15)6-19(10)18-13/h2-3,6,9H,4-5,7H2,1H3,(H,17,18,22)/t9-,14-/m1/s1 |
| InChIKey | AWRNMKIMVFNEGE-YMTOWFKASA-N |
| XLogP | 1.26 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |