C10H16N2O3 — CID 124508490
N-[(3S)-2,6-dioxopiperidin-3-yl]-2,2-dimethylpropanamide (PubChem CID 124508490) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxopiperidin-3-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 124508490 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N[C@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H16N2O3/c1-10(2,3)9(15)11-6-4-5-7(13)12-8(6)14/h6H,4-5H2,1-3H3,(H,11,15)(H,12,13,14)/t6-/m0/s1 |
| InChIKey | CYFLDDLPDPLZIT-LURJTMIESA-N |
| XLogP | -0.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|