C11H14FN — CID 124509740
(2S,5R)-2-(4-fluorophenyl)-5-methylpyrrolidine (PubChem CID 124509740) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is (2S,5R)-2-(4-fluorophenyl)-5-methylpyrrolidine.
| Compound Name | (2S,5R)-2-(4-fluorophenyl)-5-methylpyrrolidine |
|---|---|
| PubChem CID | 124509740 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (2S,5R)-2-(4-fluorophenyl)-5-methylpyrrolidine |
| SMILES | C[C@@H]1CC[C@@H](c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C11H14FN/c1-8-2-7-11(13-8)9-3-5-10(12)6-4-9/h3-6,8,11,13H,2,7H2,1H3/t8-,11+/m1/s1 |
| InChIKey | XNIGAIJJLSEEEL-KCJUWKMLSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |