About (3R)-3-phenylthian-3-ol
(3R)-3-phenylthian-3-ol (PubChem CID 124510207) has the molecular formula C11H14OS
and a molecular weight of 194.30 g/mol. Its IUPAC name is (3R)-3-phenylthian-3-ol.
Molecular Properties
| Compound Name | (3R)-3-phenylthian-3-ol |
| PubChem CID | 124510207 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (3R)-3-phenylthian-3-ol |
| SMILES | O[C@@]1(c2ccccc2)CCCSC1 |
| InChI | InChI=1S/C11H14OS/c12-11(7-4-8-13-9-11)10-5-2-1-3-6-10/h1-3,5-6,12H,4,7-9H2/t11-/m0/s1 |
| InChIKey | DGJVSQKTMWQMPE-NSHDSACASA-N |
| XLogP | 2.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-phenylthian-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-phenylthian-3-ol?
The IUPAC name of (3R)-3-phenylthian-3-ol (CID 124510207) is (3R)-3-phenylthian-3-ol.
What is the SMILES notation for (3R)-3-phenylthian-3-ol?
The canonical SMILES for (3R)-3-phenylthian-3-ol is O[C@@]1(c2ccccc2)CCCSC1.
What is the InChIKey of (3R)-3-phenylthian-3-ol?
The InChIKey is DGJVSQKTMWQMPE-NSHDSACASA-N. The full InChI is InChI=1S/C11H14OS/c12-11(7-4-8-13-9-11)10-5-2-1-3-6-10/h1-3,5-6,12H,4,7-9H2/t11-/m0/s1.
What are the key properties of (3R)-3-phenylthian-3-ol?
(3R)-3-phenylthian-3-ol has a molecular weight of 194.30 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-phenylthian-3-ol is sourced from PubChem (CID 124510207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).