About (2R)-2-methoxy-N'-methylpropanimidamide
(2R)-2-methoxy-N'-methylpropanimidamide (PubChem CID 124512055) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is (2R)-2-methoxy-N'-methylpropanimidamide.
Molecular Properties
| Compound Name | (2R)-2-methoxy-N'-methylpropanimidamide |
| PubChem CID | 124512055 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | (2R)-2-methoxy-N'-methylpropanimidamide |
| SMILES | C/N=C(\N)[C@@H](C)OC |
| InChI | InChI=1S/C5H12N2O/c1-4(8-3)5(6)7-2/h4H,1-3H3,(H2,6,7)/t4-/m1/s1 |
| InChIKey | PLWUPFGAJXCPSH-SCSAIBSYSA-N |
| XLogP | 0.01 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methoxy-N'-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methoxy-N'-methylpropanimidamide?
The IUPAC name of (2R)-2-methoxy-N'-methylpropanimidamide (CID 124512055) is (2R)-2-methoxy-N'-methylpropanimidamide.
What is the SMILES notation for (2R)-2-methoxy-N'-methylpropanimidamide?
The canonical SMILES for (2R)-2-methoxy-N'-methylpropanimidamide is C/N=C(\N)[C@@H](C)OC.
What is the InChIKey of (2R)-2-methoxy-N'-methylpropanimidamide?
The InChIKey is PLWUPFGAJXCPSH-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-4(8-3)5(6)7-2/h4H,1-3H3,(H2,6,7)/t4-/m1/s1.
What are the key properties of (2R)-2-methoxy-N'-methylpropanimidamide?
(2R)-2-methoxy-N'-methylpropanimidamide has a molecular weight of 116.16 g/mol, XLogP of 0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methoxy-N'-methylpropanimidamide is sourced from PubChem (CID 124512055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).