About cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride
cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride (PubChem CID 124513068) has the molecular formula C7H13ClO3S
and a molecular weight of 212.70 g/mol. Its IUPAC name is cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride.
Molecular Properties
| Compound Name | cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride |
| PubChem CID | 124513068 |
| Molecular Formula | C7H13ClO3S |
| Molecular Weight | 212.70 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride |
| SMILES | CO[C@@H]1CCCC[C@@H]1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H13ClO3S/c1-11-6-4-2-3-5-7(6)12(8,9)10/h6-7H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | SZSTYCAMYADOFB-RQJHMYQMSA-N |
| XLogP | 1.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.70 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride?
The IUPAC name of cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride (CID 124513068) is cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride.
What is the SMILES notation for cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride?
The canonical SMILES for cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride is CO[C@@H]1CCCC[C@@H]1S(=O)(=O)Cl.
What is the InChIKey of cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride?
The InChIKey is SZSTYCAMYADOFB-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H13ClO3S/c1-11-6-4-2-3-5-7(6)12(8,9)10/h6-7H,2-5H2,1H3/t6-,7+/m1/s1.
What are the key properties of cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride?
cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride has a molecular weight of 212.70 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-methoxycyclohexane-1-sulfonyl chloride is sourced from PubChem (CID 124513068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).