About 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide
2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide (PubChem CID 1245133) has the molecular formula C17H20N2O4S
and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide.
Molecular Properties
| Compound Name | 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide |
| PubChem CID | 1245133 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide |
| SMILES | COc1cccc(C(=O)Nc2sc(C(C)C)cc2C(N)=O)c1OC |
| InChI | InChI=1S/C17H20N2O4S/c1-9(2)13-8-11(15(18)20)17(24-13)19-16(21)10-6-5-7-12(22-3)14(10)23-4/h5-9H,1-4H3,(H2,18,20)(H,19,21) |
| InChIKey | RFVPUIBACZPPEE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide?
The IUPAC name of 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide (CID 1245133) is 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide.
What is the SMILES notation for 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide?
The canonical SMILES for 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide is COc1cccc(C(=O)Nc2sc(C(C)C)cc2C(N)=O)c1OC.
What is the InChIKey of 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide?
The InChIKey is RFVPUIBACZPPEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4S/c1-9(2)13-8-11(15(18)20)17(24-13)19-16(21)10-6-5-7-12(22-3)14(10)23-4/h5-9H,1-4H3,(H2,18,20)(H,19,21).
What are the key properties of 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide?
2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide has a molecular weight of 348.42 g/mol, XLogP of 3.24, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethoxybenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide is sourced from PubChem (CID 1245133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).